C19H18F3N3O2 — CID 122044144
3-[3-[[1-methyl-5-(trifluoromethyl)benzimidazol-2-yl]methylamino]phenyl]propanoic acid (PubChem CID 122044144) has the molecular formula C19H18F3N3O2 and a molecular weight of 377.37 g/mol. Its IUPAC name is 3-[3-[[1-methyl-5-(trifluoromethyl)benzimidazol-2-yl]methylamino]phenyl]propanoic acid.
| Compound Name | 3-[3-[[1-methyl-5-(trifluoromethyl)benzimidazol-2-yl]methylamino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 122044144 |
| Molecular Formula | C19H18F3N3O2 |
| Molecular Weight | 377.37 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 3-[3-[[1-methyl-5-(trifluoromethyl)benzimidazol-2-yl]methylamino]phenyl]propanoic acid |
| SMILES | Cn1c(CNc2cccc(CCC(=O)O)c2)nc2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C19H18F3N3O2/c1-25-16-7-6-13(19(20,21)22)10-15(16)24-17(25)11-23-14-4-2-3-12(9-14)5-8-18(26)27/h2-4,6-7,9-10,23H,5,8,11H2,1H3,(H,26,27) |
| InChIKey | FYBZUCNDRYSIMC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.37 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |