C12H15F3N4O2S — CID 131948620
2-[(dimethylsulfamoylamino)methyl]-1-methyl-5-(trifluoromethyl)benzimidazole (PubChem CID 131948620) has the molecular formula C12H15F3N4O2S and a molecular weight of 336.34 g/mol. Its IUPAC name is 2-[(dimethylsulfamoylamino)methyl]-1-methyl-5-(trifluoromethyl)benzimidazole.
| Compound Name | 2-[(dimethylsulfamoylamino)methyl]-1-methyl-5-(trifluoromethyl)benzimidazole |
|---|---|
| PubChem CID | 131948620 |
| Molecular Formula | C12H15F3N4O2S |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 2-[(dimethylsulfamoylamino)methyl]-1-methyl-5-(trifluoromethyl)benzimidazole |
| SMILES | CN(C)S(=O)(=O)NCc1nc2cc(C(F)(F)F)ccc2n1C |
| InChI | InChI=1S/C12H15F3N4O2S/c1-18(2)22(20,21)16-7-11-17-9-6-8(12(13,14)15)4-5-10(9)19(11)3/h4-6,16H,7H2,1-3H3 |
| InChIKey | RCBMFHUKUSWKNE-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |