C25H26N4O — CID 46328410
3-(dimethylamino)-N-[3-[2-(1-methylbenzimidazol-2-yl)ethyl]phenyl]benzamide (PubChem CID 46328410) has the molecular formula C25H26N4O and a molecular weight of 398.51 g/mol. Its IUPAC name is 3-(dimethylamino)-N-[3-[2-(1-methylbenzimidazol-2-yl)ethyl]phenyl]benzamide.
| Compound Name | 3-(dimethylamino)-N-[3-[2-(1-methylbenzimidazol-2-yl)ethyl]phenyl]benzamide |
|---|---|
| PubChem CID | 46328410 |
| Molecular Formula | C25H26N4O |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 3-(dimethylamino)-N-[3-[2-(1-methylbenzimidazol-2-yl)ethyl]phenyl]benzamide |
| SMILES | CN(C)c1cccc(C(=O)Nc2cccc(CCc3nc4ccccc4n3C)c2)c1 |
| InChI | InChI=1S/C25H26N4O/c1-28(2)21-11-7-9-19(17-21)25(30)26-20-10-6-8-18(16-20)14-15-24-27-22-12-4-5-13-23(22)29(24)3/h4-13,16-17H,14-15H2,1-3H3,(H,26,30) |
| InChIKey | JEWQVZJZQIEYPF-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |