C26H21N5O — CID 46290496
N-[4-[2-(1-phenylbenzimidazol-2-yl)ethyl]phenyl]pyrazine-2-carboxamide (PubChem CID 46290496) has the molecular formula C26H21N5O and a molecular weight of 419.49 g/mol. Its IUPAC name is N-[4-[2-(1-phenylbenzimidazol-2-yl)ethyl]phenyl]pyrazine-2-carboxamide.
| Compound Name | N-[4-[2-(1-phenylbenzimidazol-2-yl)ethyl]phenyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 46290496 |
| Molecular Formula | C26H21N5O |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | N-[4-[2-(1-phenylbenzimidazol-2-yl)ethyl]phenyl]pyrazine-2-carboxamide |
| SMILES | O=C(Nc1ccc(CCc2nc3ccccc3n2-c2ccccc2)cc1)c1cnccn1 |
| InChI | InChI=1S/C26H21N5O/c32-26(23-18-27-16-17-28-23)29-20-13-10-19(11-14-20)12-15-25-30-22-8-4-5-9-24(22)31(25)21-6-2-1-3-7-21/h1-11,13-14,16-18H,12,15H2,(H,29,32) |
| InChIKey | DEVOEYWPAGVACO-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |