C30H28N4O2 — CID 46382413
1-(2-methoxy-5-methylphenyl)-3-[4-[2-(1-phenylbenzimidazol-2-yl)ethyl]phenyl]urea (PubChem CID 46382413) has the molecular formula C30H28N4O2 and a molecular weight of 476.58 g/mol. Its IUPAC name is 1-(2-methoxy-5-methylphenyl)-3-[4-[2-(1-phenylbenzimidazol-2-yl)ethyl]phenyl]urea.
| Compound Name | 1-(2-methoxy-5-methylphenyl)-3-[4-[2-(1-phenylbenzimidazol-2-yl)ethyl]phenyl]urea |
|---|---|
| PubChem CID | 46382413 |
| Molecular Formula | C30H28N4O2 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | 1-(2-methoxy-5-methylphenyl)-3-[4-[2-(1-phenylbenzimidazol-2-yl)ethyl]phenyl]urea |
| SMILES | COc1ccc(C)cc1NC(=O)Nc1ccc(CCc2nc3ccccc3n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C30H28N4O2/c1-21-12-18-28(36-2)26(20-21)33-30(35)31-23-16-13-22(14-17-23)15-19-29-32-25-10-6-7-11-27(25)34(29)24-8-4-3-5-9-24/h3-14,16-18,20H,15,19H2,1-2H3,(H2,31,33,35) |
| InChIKey | HWKGBBFKHNPOIR-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |