C15H15BrN2O — CID 108869298
1-(4-bromophenyl)-3-(2,5-dimethylphenyl)urea (PubChem CID 108869298) has the molecular formula C15H15BrN2O and a molecular weight of 319.20 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-(2,5-dimethylphenyl)urea.
| Compound Name | 1-(4-bromophenyl)-3-(2,5-dimethylphenyl)urea |
|---|---|
| PubChem CID | 108869298 |
| Molecular Formula | C15H15BrN2O |
| Molecular Weight | 319.20 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | 1-(4-bromophenyl)-3-(2,5-dimethylphenyl)urea |
| SMILES | Cc1ccc(C)c(NC(=O)Nc2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C15H15BrN2O/c1-10-3-4-11(2)14(9-10)18-15(19)17-13-7-5-12(16)6-8-13/h3-9H,1-2H3,(H2,17,18,19) |
| InChIKey | CGMKXGSNJUFULP-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.20 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |