About 6-bromo-3-fluoro-6,7,8,9-tetrahydrobenzo[7]annulen-5-one
6-bromo-3-fluoro-6,7,8,9-tetrahydrobenzo[7]annulen-5-one (PubChem CID 22000390) has the molecular formula C11H10BrFO
and a molecular weight of 257.10 g/mol. Its IUPAC name is 6-bromo-3-fluoro-6,7,8,9-tetrahydrobenzo[7]annulen-5-one.
Molecular Properties
| Compound Name | 6-bromo-3-fluoro-6,7,8,9-tetrahydrobenzo[7]annulen-5-one |
| PubChem CID | 22000390 |
| Molecular Formula | C11H10BrFO |
| Molecular Weight | 257.10 g/mol |
| Exact Mass | 255.99 |
| IUPAC Name | 6-bromo-3-fluoro-6,7,8,9-tetrahydrobenzo[7]annulen-5-one |
| SMILES | O=C1c2cc(F)ccc2CCCC1Br |
| InChI | InChI=1S/C11H10BrFO/c12-10-3-1-2-7-4-5-8(13)6-9(7)11(10)14/h4-6,10H,1-3H2 |
| InChIKey | CXBVGDAYGBINMN-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.10 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-3-fluoro-6,7,8,9-tetrahydrobenzo[7]annulen-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-3-fluoro-6,7,8,9-tetrahydrobenzo[7]annulen-5-one?
The IUPAC name of 6-bromo-3-fluoro-6,7,8,9-tetrahydrobenzo[7]annulen-5-one (CID 22000390) is 6-bromo-3-fluoro-6,7,8,9-tetrahydrobenzo[7]annulen-5-one.
What is the SMILES notation for 6-bromo-3-fluoro-6,7,8,9-tetrahydrobenzo[7]annulen-5-one?
The canonical SMILES for 6-bromo-3-fluoro-6,7,8,9-tetrahydrobenzo[7]annulen-5-one is O=C1c2cc(F)ccc2CCCC1Br.
What is the InChIKey of 6-bromo-3-fluoro-6,7,8,9-tetrahydrobenzo[7]annulen-5-one?
The InChIKey is CXBVGDAYGBINMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10BrFO/c12-10-3-1-2-7-4-5-8(13)6-9(7)11(10)14/h4-6,10H,1-3H2.
What are the key properties of 6-bromo-3-fluoro-6,7,8,9-tetrahydrobenzo[7]annulen-5-one?
6-bromo-3-fluoro-6,7,8,9-tetrahydrobenzo[7]annulen-5-one has a molecular weight of 257.10 g/mol, XLogP of 3.11, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-3-fluoro-6,7,8,9-tetrahydrobenzo[7]annulen-5-one is sourced from PubChem (CID 22000390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).