C13H10BrFN2O — CID 66489611
5-bromo-1-(4-fluorophenyl)-6,7-dihydro-5H-indazol-4-one (PubChem CID 66489611) has the molecular formula C13H10BrFN2O and a molecular weight of 309.14 g/mol. Its IUPAC name is 5-bromo-1-(4-fluorophenyl)-6,7-dihydro-5H-indazol-4-one.
| Compound Name | 5-bromo-1-(4-fluorophenyl)-6,7-dihydro-5H-indazol-4-one |
|---|---|
| PubChem CID | 66489611 |
| Molecular Formula | C13H10BrFN2O |
| Molecular Weight | 309.14 g/mol |
| Exact Mass | 308.00 |
| IUPAC Name | 5-bromo-1-(4-fluorophenyl)-6,7-dihydro-5H-indazol-4-one |
| SMILES | O=C1c2cnn(-c3ccc(F)cc3)c2CCC1Br |
| InChI | InChI=1S/C13H10BrFN2O/c14-11-5-6-12-10(13(11)18)7-16-17(12)9-3-1-8(15)2-4-9/h1-4,7,11H,5-6H2 |
| InChIKey | SVMJIWGZKUONGL-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.14 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|