C24H19FN2O5S2 — CID 10185280
4-(4-fluorophenyl)-2,5-bis(4-methylsulfonylphenyl)pyridazin-3-one (PubChem CID 10185280) has the molecular formula C24H19FN2O5S2 and a molecular weight of 498.56 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-2,5-bis(4-methylsulfonylphenyl)pyridazin-3-one.
| Compound Name | 4-(4-fluorophenyl)-2,5-bis(4-methylsulfonylphenyl)pyridazin-3-one |
|---|---|
| PubChem CID | 10185280 |
| Molecular Formula | C24H19FN2O5S2 |
| Molecular Weight | 498.56 g/mol |
| Exact Mass | 498.07 |
| IUPAC Name | 4-(4-fluorophenyl)-2,5-bis(4-methylsulfonylphenyl)pyridazin-3-one |
| SMILES | CS(=O)(=O)c1ccc(-c2cnn(-c3ccc(S(C)(=O)=O)cc3)c(=O)c2-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C24H19FN2O5S2/c1-33(29,30)20-11-5-16(6-12-20)22-15-26-27(19-9-13-21(14-10-19)34(2,31)32)24(28)23(22)17-3-7-18(25)8-4-17/h3-15H,1-2H3 |
| InChIKey | PBHUMZQCBGQCCD-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 103.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.56 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |