C23H16BrFN2O3S — CID 139947672
2-(2-bromophenyl)-4-(4-fluorophenyl)-5-(4-methylsulfonylphenyl)pyridazin-3-one (PubChem CID 139947672) has the molecular formula C23H16BrFN2O3S and a molecular weight of 499.36 g/mol. Its IUPAC name is 2-(2-bromophenyl)-4-(4-fluorophenyl)-5-(4-methylsulfonylphenyl)pyridazin-3-one.
| Compound Name | 2-(2-bromophenyl)-4-(4-fluorophenyl)-5-(4-methylsulfonylphenyl)pyridazin-3-one |
|---|---|
| PubChem CID | 139947672 |
| Molecular Formula | C23H16BrFN2O3S |
| Molecular Weight | 499.36 g/mol |
| Exact Mass | 498.00 |
| IUPAC Name | 2-(2-bromophenyl)-4-(4-fluorophenyl)-5-(4-methylsulfonylphenyl)pyridazin-3-one |
| SMILES | CS(=O)(=O)c1ccc(-c2cnn(-c3ccccc3Br)c(=O)c2-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C23H16BrFN2O3S/c1-31(29,30)18-12-8-15(9-13-18)19-14-26-27(21-5-3-2-4-20(21)24)23(28)22(19)16-6-10-17(25)11-7-16/h2-14H,1H3 |
| InChIKey | GJAWIQPILOZFJY-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 69.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.36 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |