C24H18F2N2O3S — CID 19594999
4-(4-fluorophenyl)-2-[(4-fluorophenyl)methyl]-5-(3-methylsulfonylphenyl)pyridazin-3-one (PubChem CID 19594999) has the molecular formula C24H18F2N2O3S and a molecular weight of 452.48 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-2-[(4-fluorophenyl)methyl]-5-(3-methylsulfonylphenyl)pyridazin-3-one.
| Compound Name | 4-(4-fluorophenyl)-2-[(4-fluorophenyl)methyl]-5-(3-methylsulfonylphenyl)pyridazin-3-one |
|---|---|
| PubChem CID | 19594999 |
| Molecular Formula | C24H18F2N2O3S |
| Molecular Weight | 452.48 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | 4-(4-fluorophenyl)-2-[(4-fluorophenyl)methyl]-5-(3-methylsulfonylphenyl)pyridazin-3-one |
| SMILES | CS(=O)(=O)c1cccc(-c2cnn(Cc3ccc(F)cc3)c(=O)c2-c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C24H18F2N2O3S/c1-32(30,31)21-4-2-3-18(13-21)22-14-27-28(15-16-5-9-19(25)10-6-16)24(29)23(22)17-7-11-20(26)12-8-17/h2-14H,15H2,1H3 |
| InChIKey | ULEUDJKNLPDADF-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 69.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.48 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |