C23H18FN3O3S — CID 10224932
4-(4-fluorophenyl)-5-(4-methylsulfonylphenyl)-2-(pyridin-2-ylmethyl)pyridazin-3-one (PubChem CID 10224932) has the molecular formula C23H18FN3O3S and a molecular weight of 435.48 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-5-(4-methylsulfonylphenyl)-2-(pyridin-2-ylmethyl)pyridazin-3-one.
| Compound Name | 4-(4-fluorophenyl)-5-(4-methylsulfonylphenyl)-2-(pyridin-2-ylmethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 10224932 |
| Molecular Formula | C23H18FN3O3S |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | 4-(4-fluorophenyl)-5-(4-methylsulfonylphenyl)-2-(pyridin-2-ylmethyl)pyridazin-3-one |
| SMILES | CS(=O)(=O)c1ccc(-c2cnn(Cc3ccccn3)c(=O)c2-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C23H18FN3O3S/c1-31(29,30)20-11-7-16(8-12-20)21-14-26-27(15-19-4-2-3-13-25-19)23(28)22(21)17-5-9-18(24)10-6-17/h2-14H,15H2,1H3 |
| InChIKey | AQPYLLMKFQYDKV-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 81.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |