C29H21FN2O4S — CID 10142368
4-(4-fluorophenyl)-5-(4-methylsulfonylphenyl)-2-(4-phenoxyphenyl)pyridazin-3-one (PubChem CID 10142368) has the molecular formula C29H21FN2O4S and a molecular weight of 512.56 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-5-(4-methylsulfonylphenyl)-2-(4-phenoxyphenyl)pyridazin-3-one.
| Compound Name | 4-(4-fluorophenyl)-5-(4-methylsulfonylphenyl)-2-(4-phenoxyphenyl)pyridazin-3-one |
|---|---|
| PubChem CID | 10142368 |
| Molecular Formula | C29H21FN2O4S |
| Molecular Weight | 512.56 g/mol |
| Exact Mass | 512.12 |
| IUPAC Name | 4-(4-fluorophenyl)-5-(4-methylsulfonylphenyl)-2-(4-phenoxyphenyl)pyridazin-3-one |
| SMILES | CS(=O)(=O)c1ccc(-c2cnn(-c3ccc(Oc4ccccc4)cc3)c(=O)c2-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C29H21FN2O4S/c1-37(34,35)26-17-9-20(10-18-26)27-19-31-32(29(33)28(27)21-7-11-22(30)12-8-21)23-13-15-25(16-14-23)36-24-5-3-2-4-6-24/h2-19H,1H3 |
| InChIKey | PCKSLQDDRWSHPA-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.56 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |