C24H19FN2O3S — CID 10296606
4-(4-fluorophenyl)-2-(3-methylphenyl)-5-(4-methylsulfonylphenyl)pyridazin-3-one (PubChem CID 10296606) has the molecular formula C24H19FN2O3S and a molecular weight of 434.49 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-2-(3-methylphenyl)-5-(4-methylsulfonylphenyl)pyridazin-3-one.
| Compound Name | 4-(4-fluorophenyl)-2-(3-methylphenyl)-5-(4-methylsulfonylphenyl)pyridazin-3-one |
|---|---|
| PubChem CID | 10296606 |
| Molecular Formula | C24H19FN2O3S |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | 4-(4-fluorophenyl)-2-(3-methylphenyl)-5-(4-methylsulfonylphenyl)pyridazin-3-one |
| SMILES | Cc1cccc(-n2ncc(-c3ccc(S(C)(=O)=O)cc3)c(-c3ccc(F)cc3)c2=O)c1 |
| InChI | InChI=1S/C24H19FN2O3S/c1-16-4-3-5-20(14-16)27-24(28)23(18-6-10-19(25)11-7-18)22(15-26-27)17-8-12-21(13-9-17)31(2,29)30/h3-15H,1-2H3 |
| InChIKey | QCBOFMYNMKFLKG-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 69.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |