C27H20FN3O3S — CID 10206370
4-(4-fluorophenyl)-5-(4-methylsulfonylphenyl)-2-(quinolin-2-ylmethyl)pyridazin-3-one (PubChem CID 10206370) has the molecular formula C27H20FN3O3S and a molecular weight of 485.54 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-5-(4-methylsulfonylphenyl)-2-(quinolin-2-ylmethyl)pyridazin-3-one.
| Compound Name | 4-(4-fluorophenyl)-5-(4-methylsulfonylphenyl)-2-(quinolin-2-ylmethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 10206370 |
| Molecular Formula | C27H20FN3O3S |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | 4-(4-fluorophenyl)-5-(4-methylsulfonylphenyl)-2-(quinolin-2-ylmethyl)pyridazin-3-one |
| SMILES | CS(=O)(=O)c1ccc(-c2cnn(Cc3ccc4ccccc4n3)c(=O)c2-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C27H20FN3O3S/c1-35(33,34)23-14-9-18(10-15-23)24-16-29-31(27(32)26(24)20-6-11-21(28)12-7-20)17-22-13-8-19-4-2-3-5-25(19)30-22/h2-16H,17H2,1H3 |
| InChIKey | WMEJIUYUGQHTGB-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 81.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |