C27H20FN3O3S — CID 174375154
[4-[5-(4-fluorophenyl)-6-oxo-1-(quinolin-2-ylmethyl)pyridazin-4-yl]phenyl]methanesulfinic acid (PubChem CID 174375154) has the molecular formula C27H20FN3O3S and a molecular weight of 485.54 g/mol. Its IUPAC name is [4-[5-(4-fluorophenyl)-6-oxo-1-(quinolin-2-ylmethyl)pyridazin-4-yl]phenyl]methanesulfinic acid.
| Compound Name | [4-[5-(4-fluorophenyl)-6-oxo-1-(quinolin-2-ylmethyl)pyridazin-4-yl]phenyl]methanesulfinic acid |
|---|---|
| PubChem CID | 174375154 |
| Molecular Formula | C27H20FN3O3S |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | [4-[5-(4-fluorophenyl)-6-oxo-1-(quinolin-2-ylmethyl)pyridazin-4-yl]phenyl]methanesulfinic acid |
| SMILES | O=c1c(-c2ccc(F)cc2)c(-c2ccc(CS(=O)O)cc2)cnn1Cc1ccc2ccccc2n1 |
| InChI | InChI=1S/C27H20FN3O3S/c28-22-12-9-21(10-13-22)26-24(19-7-5-18(6-8-19)17-35(33)34)15-29-31(27(26)32)16-23-14-11-20-3-1-2-4-25(20)30-23/h1-15H,16-17H2,(H,33,34) |
| InChIKey | CVZCFPZXKFADNH-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|