C22H23FN2O4S — CID 174386843
[4-[1-(4-fluorophenyl)-6-oxo-5-pentoxypyridazin-4-yl]phenyl]methanesulfinic acid (PubChem CID 174386843) has the molecular formula C22H23FN2O4S and a molecular weight of 430.50 g/mol. Its IUPAC name is [4-[1-(4-fluorophenyl)-6-oxo-5-pentoxypyridazin-4-yl]phenyl]methanesulfinic acid.
| Compound Name | [4-[1-(4-fluorophenyl)-6-oxo-5-pentoxypyridazin-4-yl]phenyl]methanesulfinic acid |
|---|---|
| PubChem CID | 174386843 |
| Molecular Formula | C22H23FN2O4S |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | [4-[1-(4-fluorophenyl)-6-oxo-5-pentoxypyridazin-4-yl]phenyl]methanesulfinic acid |
| SMILES | CCCCCOc1c(-c2ccc(CS(=O)O)cc2)cnn(-c2ccc(F)cc2)c1=O |
| InChI | InChI=1S/C22H23FN2O4S/c1-2-3-4-13-29-21-20(17-7-5-16(6-8-17)15-30(27)28)14-24-25(22(21)26)19-11-9-18(23)10-12-19/h5-12,14H,2-4,13,15H2,1H3,(H,27,28) |
| InChIKey | GDNBECQMDWHUIS-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|