C24H19ClN2O3S — CID 174386320
[4-[5-benzyl-1-(3-chlorophenyl)-6-oxopyridazin-4-yl]phenyl]methanesulfinic acid (PubChem CID 174386320) has the molecular formula C24H19ClN2O3S and a molecular weight of 450.95 g/mol. Its IUPAC name is [4-[5-benzyl-1-(3-chlorophenyl)-6-oxopyridazin-4-yl]phenyl]methanesulfinic acid.
| Compound Name | [4-[5-benzyl-1-(3-chlorophenyl)-6-oxopyridazin-4-yl]phenyl]methanesulfinic acid |
|---|---|
| PubChem CID | 174386320 |
| Molecular Formula | C24H19ClN2O3S |
| Molecular Weight | 450.95 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | [4-[5-benzyl-1-(3-chlorophenyl)-6-oxopyridazin-4-yl]phenyl]methanesulfinic acid |
| SMILES | O=c1c(Cc2ccccc2)c(-c2ccc(CS(=O)O)cc2)cnn1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C24H19ClN2O3S/c25-20-7-4-8-21(14-20)27-24(28)22(13-17-5-2-1-3-6-17)23(15-26-27)19-11-9-18(10-12-19)16-31(29)30/h1-12,14-15H,13,16H2,(H,29,30) |
| InChIKey | KGGGVLWHLIEJAF-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.95 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|