C24H17ClFN2O3S- — CID 174375769
[4-[1-benzyl-5-(3-chloro-4-fluorophenyl)-6-oxopyridazin-4-yl]phenyl]methanesulfinate (PubChem CID 174375769) has the molecular formula C24H17ClFN2O3S- and a molecular weight of 467.93 g/mol. Its IUPAC name is [4-[1-benzyl-5-(3-chloro-4-fluorophenyl)-6-oxopyridazin-4-yl]phenyl]methanesulfinate.
| Compound Name | [4-[1-benzyl-5-(3-chloro-4-fluorophenyl)-6-oxopyridazin-4-yl]phenyl]methanesulfinate |
|---|---|
| PubChem CID | 174375769 |
| Molecular Formula | C24H17ClFN2O3S- |
| Molecular Weight | 467.93 g/mol |
| Exact Mass | 467.06 |
| IUPAC Name | [4-[1-benzyl-5-(3-chloro-4-fluorophenyl)-6-oxopyridazin-4-yl]phenyl]methanesulfinate |
| SMILES | O=c1c(-c2ccc(F)c(Cl)c2)c(-c2ccc(CS(=O)[O-])cc2)cnn1Cc1ccccc1 |
| InChI | InChI=1S/C24H18ClFN2O3S/c25-21-12-19(10-11-22(21)26)23-20(18-8-6-17(7-9-18)15-32(30)31)13-27-28(24(23)29)14-16-4-2-1-3-5-16/h1-13H,14-15H2,(H,30,31)/p-1 |
| InChIKey | LUPIJARJIOZAKJ-UHFFFAOYSA-M |
| XLogP | 4.80 |
| TPSA | 75.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.93 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|