C21H14FN2O3S2- — CID 174386585
[4-[5-(4-fluorophenyl)-6-oxo-1-thiophen-2-ylpyridazin-4-yl]phenyl]methanesulfinate (PubChem CID 174386585) has the molecular formula C21H14FN2O3S2- and a molecular weight of 425.49 g/mol. Its IUPAC name is [4-[5-(4-fluorophenyl)-6-oxo-1-thiophen-2-ylpyridazin-4-yl]phenyl]methanesulfinate.
| Compound Name | [4-[5-(4-fluorophenyl)-6-oxo-1-thiophen-2-ylpyridazin-4-yl]phenyl]methanesulfinate |
|---|---|
| PubChem CID | 174386585 |
| Molecular Formula | C21H14FN2O3S2- |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.04 |
| IUPAC Name | [4-[5-(4-fluorophenyl)-6-oxo-1-thiophen-2-ylpyridazin-4-yl]phenyl]methanesulfinate |
| SMILES | O=c1c(-c2ccc(F)cc2)c(-c2ccc(CS(=O)[O-])cc2)cnn1-c1cccs1 |
| InChI | InChI=1S/C21H15FN2O3S2/c22-17-9-7-16(8-10-17)20-18(15-5-3-14(4-6-15)13-29(26)27)12-23-24(21(20)25)19-2-1-11-28-19/h1-12H,13H2,(H,26,27)/p-1 |
| InChIKey | HZQWFGXOIMLAHW-UHFFFAOYSA-M |
| XLogP | 4.15 |
| TPSA | 75.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|