About [4-[2-(4-fluorophenyl)-3,4-dioxo-1H-pyridazin-5-yl]phenyl]methanesulfinate
[4-[2-(4-fluorophenyl)-3,4-dioxo-1H-pyridazin-5-yl]phenyl]methanesulfinate (PubChem CID 174386323) has the molecular formula C17H12FN2O4S-
and a molecular weight of 359.36 g/mol. Its IUPAC name is [4-[2-(4-fluorophenyl)-3,4-dioxo-1H-pyridazin-5-yl]phenyl]methanesulfinate.
Molecular Properties
| Compound Name | [4-[2-(4-fluorophenyl)-3,4-dioxo-1H-pyridazin-5-yl]phenyl]methanesulfinate |
| PubChem CID | 174386323 |
| Molecular Formula | C17H12FN2O4S- |
| Molecular Weight | 359.36 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | [4-[2-(4-fluorophenyl)-3,4-dioxo-1H-pyridazin-5-yl]phenyl]methanesulfinate |
| SMILES | O=c1c(-c2ccc(CS(=O)[O-])cc2)c[nH]n(-c2ccc(F)cc2)c1=O |
| InChI | InChI=1S/C17H13FN2O4S/c18-13-5-7-14(8-6-13)20-17(22)16(21)15(9-19-20)12-3-1-11(2-4-12)10-25(23)24/h1-9,19H,10H2,(H,23,24)/p-1 |
| InChIKey | TVHALBXDYIPTBU-UHFFFAOYSA-M |
| XLogP | 1.71 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.36 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze [4-[2-(4-fluorophenyl)-3,4-dioxo-1H-pyridazin-5-yl]phenyl]methanesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-(4-fluorophenyl)-3,4-dioxo-1H-pyridazin-5-yl]phenyl]methanesulfinate?
The IUPAC name of [4-[2-(4-fluorophenyl)-3,4-dioxo-1H-pyridazin-5-yl]phenyl]methanesulfinate (CID 174386323) is [4-[2-(4-fluorophenyl)-3,4-dioxo-1H-pyridazin-5-yl]phenyl]methanesulfinate.
What is the SMILES notation for [4-[2-(4-fluorophenyl)-3,4-dioxo-1H-pyridazin-5-yl]phenyl]methanesulfinate?
The canonical SMILES for [4-[2-(4-fluorophenyl)-3,4-dioxo-1H-pyridazin-5-yl]phenyl]methanesulfinate is O=c1c(-c2ccc(CS(=O)[O-])cc2)c[nH]n(-c2ccc(F)cc2)c1=O.
What is the InChIKey of [4-[2-(4-fluorophenyl)-3,4-dioxo-1H-pyridazin-5-yl]phenyl]methanesulfinate?
The InChIKey is TVHALBXDYIPTBU-UHFFFAOYSA-M. The full InChI is InChI=1S/C17H13FN2O4S/c18-13-5-7-14(8-6-13)20-17(22)16(21)15(9-19-20)12-3-1-11(2-4-12)10-25(23)24/h1-9,19H,10H2,(H,23,24)/p-1.
What are the key properties of [4-[2-(4-fluorophenyl)-3,4-dioxo-1H-pyridazin-5-yl]phenyl]methanesulfinate?
[4-[2-(4-fluorophenyl)-3,4-dioxo-1H-pyridazin-5-yl]phenyl]methanesulfinate has a molecular weight of 359.36 g/mol, XLogP of 1.71, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-(4-fluorophenyl)-3,4-dioxo-1H-pyridazin-5-yl]phenyl]methanesulfinate is sourced from PubChem (CID 174386323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).