C17H12FN2O4S- — CID 174386323
[4-[2-(4-fluorophenyl)-3,4-dioxo-1H-pyridazin-5-yl]phenyl]methanesulfinate (PubChem CID 174386323) has the molecular formula C17H12FN2O4S- and a molecular weight of 359.36 g/mol. Its IUPAC name is [4-[2-(4-fluorophenyl)-3,4-dioxo-1H-pyridazin-5-yl]phenyl]methanesulfinate.
| Compound Name | [4-[2-(4-fluorophenyl)-3,4-dioxo-1H-pyridazin-5-yl]phenyl]methanesulfinate |
|---|---|
| PubChem CID | 174386323 |
| Molecular Formula | C17H12FN2O4S- |
| Molecular Weight | 359.36 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | [4-[2-(4-fluorophenyl)-3,4-dioxo-1H-pyridazin-5-yl]phenyl]methanesulfinate |
| SMILES | O=c1c(-c2ccc(CS(=O)[O-])cc2)c[nH]n(-c2ccc(F)cc2)c1=O |
| InChI | InChI=1S/C17H13FN2O4S/c18-13-5-7-14(8-6-13)20-17(22)16(21)15(9-19-20)12-3-1-11(2-4-12)10-25(23)24/h1-9,19H,10H2,(H,23,24)/p-1 |
| InChIKey | TVHALBXDYIPTBU-UHFFFAOYSA-M |
| XLogP | 1.71 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.36 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|