C17H14FNO2S — CID 174382296
[4-[1-(4-fluorophenyl)pyrrol-2-yl]phenyl]methanesulfinic acid (PubChem CID 174382296) has the molecular formula C17H14FNO2S and a molecular weight of 315.37 g/mol. Its IUPAC name is [4-[1-(4-fluorophenyl)pyrrol-2-yl]phenyl]methanesulfinic acid.
| Compound Name | [4-[1-(4-fluorophenyl)pyrrol-2-yl]phenyl]methanesulfinic acid |
|---|---|
| PubChem CID | 174382296 |
| Molecular Formula | C17H14FNO2S |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | [4-[1-(4-fluorophenyl)pyrrol-2-yl]phenyl]methanesulfinic acid |
| SMILES | O=S(O)Cc1ccc(-c2cccn2-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C17H14FNO2S/c18-15-7-9-16(10-8-15)19-11-1-2-17(19)14-5-3-13(4-6-14)12-22(20)21/h1-11H,12H2,(H,20,21) |
| InChIKey | IRDWJSOFTIWDLQ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|