C23H18FNO3S — CID 70335054
[4-[4-(4-fluorophenyl)-5-oxo-1-phenyl-2H-pyrrol-3-yl]phenyl]methanesulfinic acid (PubChem CID 70335054) has the molecular formula C23H18FNO3S and a molecular weight of 407.47 g/mol. Its IUPAC name is [4-[4-(4-fluorophenyl)-5-oxo-1-phenyl-2H-pyrrol-3-yl]phenyl]methanesulfinic acid.
| Compound Name | [4-[4-(4-fluorophenyl)-5-oxo-1-phenyl-2H-pyrrol-3-yl]phenyl]methanesulfinic acid |
|---|---|
| PubChem CID | 70335054 |
| Molecular Formula | C23H18FNO3S |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | [4-[4-(4-fluorophenyl)-5-oxo-1-phenyl-2H-pyrrol-3-yl]phenyl]methanesulfinic acid |
| SMILES | O=C1C(c2ccc(F)cc2)=C(c2ccc(CS(=O)O)cc2)CN1c1ccccc1 |
| InChI | InChI=1S/C23H18FNO3S/c24-19-12-10-18(11-13-19)22-21(17-8-6-16(7-9-17)15-29(27)28)14-25(23(22)26)20-4-2-1-3-5-20/h1-13H,14-15H2,(H,27,28) |
| InChIKey | SFHPQWYUCKOVEL-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|