C23H17FO4S — CID 174376185
[4-[3-(4-fluorophenyl)-4-formyl-4H-chromen-2-yl]phenyl]methanesulfinic acid (PubChem CID 174376185) has the molecular formula C23H17FO4S and a molecular weight of 408.45 g/mol. Its IUPAC name is [4-[3-(4-fluorophenyl)-4-formyl-4H-chromen-2-yl]phenyl]methanesulfinic acid.
| Compound Name | [4-[3-(4-fluorophenyl)-4-formyl-4H-chromen-2-yl]phenyl]methanesulfinic acid |
|---|---|
| PubChem CID | 174376185 |
| Molecular Formula | C23H17FO4S |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | [4-[3-(4-fluorophenyl)-4-formyl-4H-chromen-2-yl]phenyl]methanesulfinic acid |
| SMILES | O=CC1C(c2ccc(F)cc2)=C(c2ccc(CS(=O)O)cc2)Oc2ccccc21 |
| InChI | InChI=1S/C23H17FO4S/c24-18-11-9-16(10-12-18)22-20(13-25)19-3-1-2-4-21(19)28-23(22)17-7-5-15(6-8-17)14-29(26)27/h1-13,20H,14H2,(H,26,27) |
| InChIKey | ZCJHCXNJQWJBHL-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|