C27H19O4S- — CID 174364548
[4-(4-formyl-3-naphthalen-1-yl-4H-chromen-2-yl)phenyl]methanesulfinate (PubChem CID 174364548) has the molecular formula C27H19O4S- and a molecular weight of 439.51 g/mol. Its IUPAC name is [4-(4-formyl-3-naphthalen-1-yl-4H-chromen-2-yl)phenyl]methanesulfinate.
| Compound Name | [4-(4-formyl-3-naphthalen-1-yl-4H-chromen-2-yl)phenyl]methanesulfinate |
|---|---|
| PubChem CID | 174364548 |
| Molecular Formula | C27H19O4S- |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | [4-(4-formyl-3-naphthalen-1-yl-4H-chromen-2-yl)phenyl]methanesulfinate |
| SMILES | O=CC1C(c2cccc3ccccc23)=C(c2ccc(CS(=O)[O-])cc2)Oc2ccccc21 |
| InChI | InChI=1S/C27H20O4S/c28-16-24-22-9-3-4-11-25(22)31-27(20-14-12-18(13-15-20)17-32(29)30)26(24)23-10-5-7-19-6-1-2-8-21(19)23/h1-16,24H,17H2,(H,29,30)/p-1 |
| InChIKey | NAAJJSPTXYINJN-UHFFFAOYSA-M |
| XLogP | 5.46 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|