C23H20N2O4S — CID 174363991
4-[3-[2-(aminomethyl)phenyl]-4-formyl-4H-chromen-2-yl]benzenesulfonamide (PubChem CID 174363991) has the molecular formula C23H20N2O4S and a molecular weight of 420.49 g/mol. Its IUPAC name is 4-[3-[2-(aminomethyl)phenyl]-4-formyl-4H-chromen-2-yl]benzenesulfonamide.
| Compound Name | 4-[3-[2-(aminomethyl)phenyl]-4-formyl-4H-chromen-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 174363991 |
| Molecular Formula | C23H20N2O4S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | 4-[3-[2-(aminomethyl)phenyl]-4-formyl-4H-chromen-2-yl]benzenesulfonamide |
| SMILES | NCc1ccccc1C1=C(c2ccc(S(N)(=O)=O)cc2)Oc2ccccc2C1C=O |
| InChI | InChI=1S/C23H20N2O4S/c24-13-16-5-1-2-6-18(16)22-20(14-26)19-7-3-4-8-21(19)29-23(22)15-9-11-17(12-10-15)30(25,27)28/h1-12,14,20H,13,24H2,(H2,25,27,28) |
| InChIKey | YCAFLHIPEHYQGE-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 112.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|