C22H16ClNO4S — CID 174374747
4-[3-(4-chlorophenyl)-4-formyl-4H-chromen-2-yl]benzenesulfonamide (PubChem CID 174374747) has the molecular formula C22H16ClNO4S and a molecular weight of 425.89 g/mol. Its IUPAC name is 4-[3-(4-chlorophenyl)-4-formyl-4H-chromen-2-yl]benzenesulfonamide.
| Compound Name | 4-[3-(4-chlorophenyl)-4-formyl-4H-chromen-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 174374747 |
| Molecular Formula | C22H16ClNO4S |
| Molecular Weight | 425.89 g/mol |
| Exact Mass | 425.05 |
| IUPAC Name | 4-[3-(4-chlorophenyl)-4-formyl-4H-chromen-2-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(C2=C(c3ccc(Cl)cc3)C(C=O)c3ccccc3O2)cc1 |
| InChI | InChI=1S/C22H16ClNO4S/c23-16-9-5-14(6-10-16)21-19(13-25)18-3-1-2-4-20(18)28-22(21)15-7-11-17(12-8-15)29(24,26)27/h1-13,19H,(H2,24,26,27) |
| InChIKey | SIUCECGVRPHGTJ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.89 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|