C23H16FO4S- — CID 174375895
[4-[3-(3-fluorophenyl)-4-formyl-4H-chromen-2-yl]phenyl]methanesulfinate (PubChem CID 174375895) has the molecular formula C23H16FO4S- and a molecular weight of 407.44 g/mol. Its IUPAC name is [4-[3-(3-fluorophenyl)-4-formyl-4H-chromen-2-yl]phenyl]methanesulfinate.
| Compound Name | [4-[3-(3-fluorophenyl)-4-formyl-4H-chromen-2-yl]phenyl]methanesulfinate |
|---|---|
| PubChem CID | 174375895 |
| Molecular Formula | C23H16FO4S- |
| Molecular Weight | 407.44 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | [4-[3-(3-fluorophenyl)-4-formyl-4H-chromen-2-yl]phenyl]methanesulfinate |
| SMILES | O=CC1C(c2cccc(F)c2)=C(c2ccc(CS(=O)[O-])cc2)Oc2ccccc21 |
| InChI | InChI=1S/C23H17FO4S/c24-18-5-3-4-17(12-18)22-20(13-25)19-6-1-2-7-21(19)28-23(22)16-10-8-15(9-11-16)14-29(26)27/h1-13,20H,14H2,(H,26,27)/p-1 |
| InChIKey | RBGDZJRQIHMTQG-UHFFFAOYSA-M |
| XLogP | 4.45 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.44 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|