C18H14F2O2 — CID 174801175
3-(3,5-difluorophenyl)-2-ethyl-4H-chromene-4-carbaldehyde (PubChem CID 174801175) has the molecular formula C18H14F2O2 and a molecular weight of 300.30 g/mol. Its IUPAC name is 3-(3,5-difluorophenyl)-2-ethyl-4H-chromene-4-carbaldehyde.
| Compound Name | 3-(3,5-difluorophenyl)-2-ethyl-4H-chromene-4-carbaldehyde |
|---|---|
| PubChem CID | 174801175 |
| Molecular Formula | C18H14F2O2 |
| Molecular Weight | 300.30 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 3-(3,5-difluorophenyl)-2-ethyl-4H-chromene-4-carbaldehyde |
| SMILES | CCC1=C(c2cc(F)cc(F)c2)C(C=O)c2ccccc2O1 |
| InChI | InChI=1S/C18H14F2O2/c1-2-16-18(11-7-12(19)9-13(20)8-11)15(10-21)14-5-3-4-6-17(14)22-16/h3-10,15H,2H2,1H3 |
| InChIKey | ASTUIJRJNIGQLS-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.30 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|