C22H15ClFNO4S — CID 174363983
[4-[3-(6-chloro-3-pyridinyl)-6-fluoro-4-formyl-4H-chromen-2-yl]phenyl]methanesulfinic acid (PubChem CID 174363983) has the molecular formula C22H15ClFNO4S and a molecular weight of 443.88 g/mol. Its IUPAC name is [4-[3-(6-chloro-3-pyridinyl)-6-fluoro-4-formyl-4H-chromen-2-yl]phenyl]methanesulfinic acid.
| Compound Name | [4-[3-(6-chloro-3-pyridinyl)-6-fluoro-4-formyl-4H-chromen-2-yl]phenyl]methanesulfinic acid |
|---|---|
| PubChem CID | 174363983 |
| Molecular Formula | C22H15ClFNO4S |
| Molecular Weight | 443.88 g/mol |
| Exact Mass | 443.04 |
| IUPAC Name | [4-[3-(6-chloro-3-pyridinyl)-6-fluoro-4-formyl-4H-chromen-2-yl]phenyl]methanesulfinic acid |
| SMILES | O=CC1C(c2ccc(Cl)nc2)=C(c2ccc(CS(=O)O)cc2)Oc2ccc(F)cc21 |
| InChI | InChI=1S/C22H15ClFNO4S/c23-20-8-5-15(10-25-20)21-18(11-26)17-9-16(24)6-7-19(17)29-22(21)14-3-1-13(2-4-14)12-30(27)28/h1-11,18H,12H2,(H,27,28) |
| InChIKey | WJPGENPMBSJFTJ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.88 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|