C17H12F4N2O2S — CID 174491571
[4-[4-(4-fluorophenyl)-5-(trifluoromethyl)-1H-pyrazol-3-yl]phenyl]methanesulfinic acid (PubChem CID 174491571) has the molecular formula C17H12F4N2O2S and a molecular weight of 384.35 g/mol. Its IUPAC name is [4-[4-(4-fluorophenyl)-5-(trifluoromethyl)-1H-pyrazol-3-yl]phenyl]methanesulfinic acid.
| Compound Name | [4-[4-(4-fluorophenyl)-5-(trifluoromethyl)-1H-pyrazol-3-yl]phenyl]methanesulfinic acid |
|---|---|
| PubChem CID | 174491571 |
| Molecular Formula | C17H12F4N2O2S |
| Molecular Weight | 384.35 g/mol |
| Exact Mass | 384.06 |
| IUPAC Name | [4-[4-(4-fluorophenyl)-5-(trifluoromethyl)-1H-pyrazol-3-yl]phenyl]methanesulfinic acid |
| SMILES | O=S(O)Cc1ccc(-c2n[nH]c(C(F)(F)F)c2-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C17H12F4N2O2S/c18-13-7-5-11(6-8-13)14-15(22-23-16(14)17(19,20)21)12-3-1-10(2-4-12)9-26(24)25/h1-8H,9H2,(H,22,23)(H,24,25) |
| InChIKey | RQWHNZDABUQWPH-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.35 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|