C19H13F4NO2S — CID 174961708
[4-[2-(4-fluorophenyl)-6-(trifluoromethyl)-4-pyridinyl]phenyl]methanesulfinic acid (PubChem CID 174961708) has the molecular formula C19H13F4NO2S and a molecular weight of 395.38 g/mol. Its IUPAC name is [4-[2-(4-fluorophenyl)-6-(trifluoromethyl)-4-pyridinyl]phenyl]methanesulfinic acid.
| Compound Name | [4-[2-(4-fluorophenyl)-6-(trifluoromethyl)-4-pyridinyl]phenyl]methanesulfinic acid |
|---|---|
| PubChem CID | 174961708 |
| Molecular Formula | C19H13F4NO2S |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | [4-[2-(4-fluorophenyl)-6-(trifluoromethyl)-4-pyridinyl]phenyl]methanesulfinic acid |
| SMILES | O=S(O)Cc1ccc(-c2cc(-c3ccc(F)cc3)nc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C19H13F4NO2S/c20-16-7-5-14(6-8-16)17-9-15(10-18(24-17)19(21,22)23)13-3-1-12(2-4-13)11-27(25)26/h1-10H,11H2,(H,25,26) |
| InChIKey | VXKOQQXPLQLFJM-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|