C20H21FO2S — CID 174470442
[4-[2-(4-fluorophenyl)-4,4-dimethylcyclopenten-1-yl]phenyl]methanesulfinic acid (PubChem CID 174470442) has the molecular formula C20H21FO2S and a molecular weight of 344.45 g/mol. Its IUPAC name is [4-[2-(4-fluorophenyl)-4,4-dimethylcyclopenten-1-yl]phenyl]methanesulfinic acid.
| Compound Name | [4-[2-(4-fluorophenyl)-4,4-dimethylcyclopenten-1-yl]phenyl]methanesulfinic acid |
|---|---|
| PubChem CID | 174470442 |
| Molecular Formula | C20H21FO2S |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | [4-[2-(4-fluorophenyl)-4,4-dimethylcyclopenten-1-yl]phenyl]methanesulfinic acid |
| SMILES | CC1(C)CC(c2ccc(F)cc2)=C(c2ccc(CS(=O)O)cc2)C1 |
| InChI | InChI=1S/C20H21FO2S/c1-20(2)11-18(15-5-3-14(4-6-15)13-24(22)23)19(12-20)16-7-9-17(21)10-8-16/h3-10H,11-13H2,1-2H3,(H,22,23) |
| InChIKey | DEZFXHGKSTYOTJ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|