C17H13F3N2O2S — CID 174470431
[4-[2-phenyl-4-(trifluoromethyl)imidazol-1-yl]phenyl]methanesulfinic acid (PubChem CID 174470431) has the molecular formula C17H13F3N2O2S and a molecular weight of 366.36 g/mol. Its IUPAC name is [4-[2-phenyl-4-(trifluoromethyl)imidazol-1-yl]phenyl]methanesulfinic acid.
| Compound Name | [4-[2-phenyl-4-(trifluoromethyl)imidazol-1-yl]phenyl]methanesulfinic acid |
|---|---|
| PubChem CID | 174470431 |
| Molecular Formula | C17H13F3N2O2S |
| Molecular Weight | 366.36 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | [4-[2-phenyl-4-(trifluoromethyl)imidazol-1-yl]phenyl]methanesulfinic acid |
| SMILES | O=S(O)Cc1ccc(-n2cc(C(F)(F)F)nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C17H13F3N2O2S/c18-17(19,20)15-10-22(16(21-15)13-4-2-1-3-5-13)14-8-6-12(7-9-14)11-25(23)24/h1-10H,11H2,(H,23,24) |
| InChIKey | QMTKRJJBDDAHLG-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.36 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|