C16H12F3N3O2S — CID 10155819
4-[2-phenyl-4-(trifluoromethyl)imidazol-1-yl]benzenesulfonamide (PubChem CID 10155819) has the molecular formula C16H12F3N3O2S and a molecular weight of 367.35 g/mol. Its IUPAC name is 4-[2-phenyl-4-(trifluoromethyl)imidazol-1-yl]benzenesulfonamide.
| Compound Name | 4-[2-phenyl-4-(trifluoromethyl)imidazol-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 10155819 |
| Molecular Formula | C16H12F3N3O2S |
| Molecular Weight | 367.35 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | 4-[2-phenyl-4-(trifluoromethyl)imidazol-1-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(-n2cc(C(F)(F)F)nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C16H12F3N3O2S/c17-16(18,19)14-10-22(15(21-14)11-4-2-1-3-5-11)12-6-8-13(9-7-12)25(20,23)24/h1-10H,(H2,20,23,24) |
| InChIKey | FQZPECQXBKABHG-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.35 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |