C25H19F4N3O3S — CID 174423408
[4-[1-(2-anilino-2-oxoethyl)-4-(4-fluorophenyl)-5-(trifluoromethyl)pyrazol-3-yl]phenyl]methanesulfinic acid (PubChem CID 174423408) has the molecular formula C25H19F4N3O3S and a molecular weight of 517.50 g/mol. Its IUPAC name is [4-[1-(2-anilino-2-oxoethyl)-4-(4-fluorophenyl)-5-(trifluoromethyl)pyrazol-3-yl]phenyl]methanesulfinic acid.
| Compound Name | [4-[1-(2-anilino-2-oxoethyl)-4-(4-fluorophenyl)-5-(trifluoromethyl)pyrazol-3-yl]phenyl]methanesulfinic acid |
|---|---|
| PubChem CID | 174423408 |
| Molecular Formula | C25H19F4N3O3S |
| Molecular Weight | 517.50 g/mol |
| Exact Mass | 517.11 |
| IUPAC Name | [4-[1-(2-anilino-2-oxoethyl)-4-(4-fluorophenyl)-5-(trifluoromethyl)pyrazol-3-yl]phenyl]methanesulfinic acid |
| SMILES | O=C(Cn1nc(-c2ccc(CS(=O)O)cc2)c(-c2ccc(F)cc2)c1C(F)(F)F)Nc1ccccc1 |
| InChI | InChI=1S/C25H19F4N3O3S/c26-19-12-10-17(11-13-19)22-23(18-8-6-16(7-9-18)15-36(34)35)31-32(24(22)25(27,28)29)14-21(33)30-20-4-2-1-3-5-20/h1-13H,14-15H2,(H,30,33)(H,34,35) |
| InChIKey | BXUGWXSOBQHIHC-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.50 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|