C19H15F4N2O2S- — CID 174457746
[4-[1-ethyl-4-(4-fluorophenyl)-5-(trifluoromethyl)pyrazol-3-yl]phenyl]methanesulfinate (PubChem CID 174457746) has the molecular formula C19H15F4N2O2S- and a molecular weight of 411.40 g/mol. Its IUPAC name is [4-[1-ethyl-4-(4-fluorophenyl)-5-(trifluoromethyl)pyrazol-3-yl]phenyl]methanesulfinate.
| Compound Name | [4-[1-ethyl-4-(4-fluorophenyl)-5-(trifluoromethyl)pyrazol-3-yl]phenyl]methanesulfinate |
|---|---|
| PubChem CID | 174457746 |
| Molecular Formula | C19H15F4N2O2S- |
| Molecular Weight | 411.40 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | [4-[1-ethyl-4-(4-fluorophenyl)-5-(trifluoromethyl)pyrazol-3-yl]phenyl]methanesulfinate |
| SMILES | CCn1nc(-c2ccc(CS(=O)[O-])cc2)c(-c2ccc(F)cc2)c1C(F)(F)F |
| InChI | InChI=1S/C19H16F4N2O2S/c1-2-25-18(19(21,22)23)16(13-7-9-15(20)10-8-13)17(24-25)14-5-3-12(4-6-14)11-28(26)27/h3-10H,2,11H2,1H3,(H,26,27)/p-1 |
| InChIKey | KAJZKENHZFZMQM-UHFFFAOYSA-M |
| XLogP | 4.77 |
| TPSA | 57.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.40 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|