C17H11F3NO3S- — CID 174716088
[4-[4-phenyl-5-(trifluoromethyl)-1,2-oxazol-3-yl]phenyl]methanesulfinate (PubChem CID 174716088) has the molecular formula C17H11F3NO3S- and a molecular weight of 366.34 g/mol. Its IUPAC name is [4-[4-phenyl-5-(trifluoromethyl)-1,2-oxazol-3-yl]phenyl]methanesulfinate.
| Compound Name | [4-[4-phenyl-5-(trifluoromethyl)-1,2-oxazol-3-yl]phenyl]methanesulfinate |
|---|---|
| PubChem CID | 174716088 |
| Molecular Formula | C17H11F3NO3S- |
| Molecular Weight | 366.34 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | [4-[4-phenyl-5-(trifluoromethyl)-1,2-oxazol-3-yl]phenyl]methanesulfinate |
| SMILES | O=S([O-])Cc1ccc(-c2noc(C(F)(F)F)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C17H12F3NO3S/c18-17(19,20)16-14(12-4-2-1-3-5-12)15(21-24-16)13-8-6-11(7-9-13)10-25(22)23/h1-9H,10H2,(H,22,23)/p-1 |
| InChIKey | AEFVIMRYCZNVKQ-UHFFFAOYSA-M |
| XLogP | 4.41 |
| TPSA | 66.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.34 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|