C17H15FNO3S- — CID 122659358
[4-[(4S,5R)-4-(fluoromethyl)-2-phenyl-4,5-dihydro-1,3-oxazol-5-yl]phenyl]methanesulfinate (PubChem CID 122659358) has the molecular formula C17H15FNO3S- and a molecular weight of 332.38 g/mol. Its IUPAC name is [4-[(4S,5R)-4-(fluoromethyl)-2-phenyl-4,5-dihydro-1,3-oxazol-5-yl]phenyl]methanesulfinate.
| Compound Name | [4-[(4S,5R)-4-(fluoromethyl)-2-phenyl-4,5-dihydro-1,3-oxazol-5-yl]phenyl]methanesulfinate |
|---|---|
| PubChem CID | 122659358 |
| Molecular Formula | C17H15FNO3S- |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | [4-[(4S,5R)-4-(fluoromethyl)-2-phenyl-4,5-dihydro-1,3-oxazol-5-yl]phenyl]methanesulfinate |
| SMILES | O=S([O-])Cc1ccc([C@H]2OC(c3ccccc3)=N[C@@H]2CF)cc1 |
| InChI | InChI=1S/C17H16FNO3S/c18-10-15-16(13-8-6-12(7-9-13)11-23(20)21)22-17(19-15)14-4-2-1-3-5-14/h1-9,15-16H,10-11H2,(H,20,21)/p-1/t15-,16-/m1/s1 |
| InChIKey | DMHJZIMWDGQKTM-HZPDHXFCSA-M |
| XLogP | 2.92 |
| TPSA | 61.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|