C18H19NO4S2 — CID 101410143
[(4S,5S)-5-(4-methylsulfanylphenyl)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]methyl methanesulfonate (PubChem CID 101410143) has the molecular formula C18H19NO4S2 and a molecular weight of 377.49 g/mol. Its IUPAC name is [(4S,5S)-5-(4-methylsulfanylphenyl)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]methyl methanesulfonate.
| Compound Name | [(4S,5S)-5-(4-methylsulfanylphenyl)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 101410143 |
| Molecular Formula | C18H19NO4S2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | [(4S,5S)-5-(4-methylsulfanylphenyl)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]methyl methanesulfonate |
| SMILES | CSc1ccc([C@@H]2OC(c3ccccc3)=N[C@H]2COS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C18H19NO4S2/c1-24-15-10-8-13(9-11-15)17-16(12-22-25(2,20)21)19-18(23-17)14-6-4-3-5-7-14/h3-11,16-17H,12H2,1-2H3/t16-,17-/m0/s1 |
| InChIKey | MJSHJYNTVDJVIU-IRXDYDNUSA-N |
| XLogP | 3.27 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|