About 2-(5-methyl-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl)acetic acid
2-(5-methyl-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl)acetic acid (PubChem CID 18377518) has the molecular formula C12H13NO3
and a molecular weight of 219.24 g/mol. Its IUPAC name is 2-(5-methyl-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl)acetic acid.
Analyze 2-(5-methyl-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-methyl-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl)acetic acid?
The IUPAC name of 2-(5-methyl-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl)acetic acid (CID 18377518) is 2-(5-methyl-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl)acetic acid.
What is the SMILES notation for 2-(5-methyl-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl)acetic acid?
The canonical SMILES for 2-(5-methyl-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl)acetic acid is CC1OC(c2ccccc2)=NC1CC(=O)O.
What is the InChIKey of 2-(5-methyl-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl)acetic acid?
The InChIKey is ZMRGXJPDUIKSGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO3/c1-8-10(7-11(14)15)13-12(16-8)9-5-3-2-4-6-9/h2-6,8,10H,7H2,1H3,(H,14,15).
What are the key properties of 2-(5-methyl-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl)acetic acid?
2-(5-methyl-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl)acetic acid has a molecular weight of 219.24 g/mol, XLogP of 1.70, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-methyl-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl)acetic acid is sourced from PubChem (CID 18377518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).