C21H21O4S- — CID 174372305
[4-(5,5-diethyl-4-oxo-3-phenylfuran-2-yl)phenyl]methanesulfinate (PubChem CID 174372305) has the molecular formula C21H21O4S- and a molecular weight of 369.46 g/mol. Its IUPAC name is [4-(5,5-diethyl-4-oxo-3-phenylfuran-2-yl)phenyl]methanesulfinate.
| Compound Name | [4-(5,5-diethyl-4-oxo-3-phenylfuran-2-yl)phenyl]methanesulfinate |
|---|---|
| PubChem CID | 174372305 |
| Molecular Formula | C21H21O4S- |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | [4-(5,5-diethyl-4-oxo-3-phenylfuran-2-yl)phenyl]methanesulfinate |
| SMILES | CCC1(CC)OC(c2ccc(CS(=O)[O-])cc2)=C(c2ccccc2)C1=O |
| InChI | InChI=1S/C21H22O4S/c1-3-21(4-2)20(22)18(16-8-6-5-7-9-16)19(25-21)17-12-10-15(11-13-17)14-26(23)24/h5-13H,3-4,14H2,1-2H3,(H,23,24)/p-1 |
| InChIKey | KBZBWACEMRBJJD-UHFFFAOYSA-M |
| XLogP | 4.09 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|