C23H26O6S — CID 18385679
4-(3,4-dimethoxyphenyl)-2,2-diethyl-5-(4-methylsulfonylphenyl)furan-3-one (PubChem CID 18385679) has the molecular formula C23H26O6S and a molecular weight of 430.52 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-2,2-diethyl-5-(4-methylsulfonylphenyl)furan-3-one.
| Compound Name | 4-(3,4-dimethoxyphenyl)-2,2-diethyl-5-(4-methylsulfonylphenyl)furan-3-one |
|---|---|
| PubChem CID | 18385679 |
| Molecular Formula | C23H26O6S |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)-2,2-diethyl-5-(4-methylsulfonylphenyl)furan-3-one |
| SMILES | CCC1(CC)OC(c2ccc(S(C)(=O)=O)cc2)=C(c2ccc(OC)c(OC)c2)C1=O |
| InChI | InChI=1S/C23H26O6S/c1-6-23(7-2)22(24)20(16-10-13-18(27-3)19(14-16)28-4)21(29-23)15-8-11-17(12-9-15)30(5,25)26/h8-14H,6-7H2,1-5H3 |
| InChIKey | WWKBVLVGTJBEHM-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|