C23H23ClO5S — CID 18385757
4-(4-acetyl-2-chlorophenyl)-2,2-diethyl-5-(4-methylsulfonylphenyl)furan-3-one (PubChem CID 18385757) has the molecular formula C23H23ClO5S and a molecular weight of 446.95 g/mol. Its IUPAC name is 4-(4-acetyl-2-chlorophenyl)-2,2-diethyl-5-(4-methylsulfonylphenyl)furan-3-one.
| Compound Name | 4-(4-acetyl-2-chlorophenyl)-2,2-diethyl-5-(4-methylsulfonylphenyl)furan-3-one |
|---|---|
| PubChem CID | 18385757 |
| Molecular Formula | C23H23ClO5S |
| Molecular Weight | 446.95 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | 4-(4-acetyl-2-chlorophenyl)-2,2-diethyl-5-(4-methylsulfonylphenyl)furan-3-one |
| SMILES | CCC1(CC)OC(c2ccc(S(C)(=O)=O)cc2)=C(c2ccc(C(C)=O)cc2Cl)C1=O |
| InChI | InChI=1S/C23H23ClO5S/c1-5-23(6-2)22(26)20(18-12-9-16(14(3)25)13-19(18)24)21(29-23)15-7-10-17(11-8-15)30(4,27)28/h7-13H,5-6H2,1-4H3 |
| InChIKey | NPBFHCBCSYQOFP-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.95 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|