C20H20O6S — CID 142642921
4-(4-hydroxy-2-methoxyphenyl)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-one (PubChem CID 142642921) has the molecular formula C20H20O6S and a molecular weight of 388.44 g/mol. Its IUPAC name is 4-(4-hydroxy-2-methoxyphenyl)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-one.
| Compound Name | 4-(4-hydroxy-2-methoxyphenyl)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-one |
|---|---|
| PubChem CID | 142642921 |
| Molecular Formula | C20H20O6S |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 4-(4-hydroxy-2-methoxyphenyl)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-one |
| SMILES | COc1cc(O)ccc1C1=C(c2ccc(S(C)(=O)=O)cc2)OC(C)(C)C1=O |
| InChI | InChI=1S/C20H20O6S/c1-20(2)19(22)17(15-10-7-13(21)11-16(15)25-3)18(26-20)12-5-8-14(9-6-12)27(4,23)24/h5-11,21H,1-4H3 |
| InChIKey | CHCISLOZYOMVIF-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|