C22H21ClO5S — CID 18386079
4-(3-acetyl-4-chlorophenyl)-2-ethyl-2-methyl-5-(4-methylsulfonylphenyl)furan-3-one (PubChem CID 18386079) has the molecular formula C22H21ClO5S and a molecular weight of 432.93 g/mol. Its IUPAC name is 4-(3-acetyl-4-chlorophenyl)-2-ethyl-2-methyl-5-(4-methylsulfonylphenyl)furan-3-one.
| Compound Name | 4-(3-acetyl-4-chlorophenyl)-2-ethyl-2-methyl-5-(4-methylsulfonylphenyl)furan-3-one |
|---|---|
| PubChem CID | 18386079 |
| Molecular Formula | C22H21ClO5S |
| Molecular Weight | 432.93 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | 4-(3-acetyl-4-chlorophenyl)-2-ethyl-2-methyl-5-(4-methylsulfonylphenyl)furan-3-one |
| SMILES | CCC1(C)OC(c2ccc(S(C)(=O)=O)cc2)=C(c2ccc(Cl)c(C(C)=O)c2)C1=O |
| InChI | InChI=1S/C22H21ClO5S/c1-5-22(3)21(25)19(15-8-11-18(23)17(12-15)13(2)24)20(28-22)14-6-9-16(10-7-14)29(4,26)27/h6-12H,5H2,1-4H3 |
| InChIKey | HFDBTKIQIRRPNI-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.93 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|