C19H20O4S2 — CID 18385934
2,2-diethyl-5-(4-methylsulfonylphenyl)-4-thiophen-3-ylfuran-3-one (PubChem CID 18385934) has the molecular formula C19H20O4S2 and a molecular weight of 376.50 g/mol. Its IUPAC name is 2,2-diethyl-5-(4-methylsulfonylphenyl)-4-thiophen-3-ylfuran-3-one.
| Compound Name | 2,2-diethyl-5-(4-methylsulfonylphenyl)-4-thiophen-3-ylfuran-3-one |
|---|---|
| PubChem CID | 18385934 |
| Molecular Formula | C19H20O4S2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 2,2-diethyl-5-(4-methylsulfonylphenyl)-4-thiophen-3-ylfuran-3-one |
| SMILES | CCC1(CC)OC(c2ccc(S(C)(=O)=O)cc2)=C(c2ccsc2)C1=O |
| InChI | InChI=1S/C19H20O4S2/c1-4-19(5-2)18(20)16(14-10-11-24-12-14)17(23-19)13-6-8-15(9-7-13)25(3,21)22/h6-12H,4-5H2,1-3H3 |
| InChIKey | HNYBOUVKEVWFBB-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |