C20H21NO4S — CID 18385609
2-ethyl-2-methyl-4-(6-methyl-2-pyridinyl)-5-(4-methylsulfonylphenyl)furan-3-one (PubChem CID 18385609) has the molecular formula C20H21NO4S and a molecular weight of 371.46 g/mol. Its IUPAC name is 2-ethyl-2-methyl-4-(6-methyl-2-pyridinyl)-5-(4-methylsulfonylphenyl)furan-3-one.
| Compound Name | 2-ethyl-2-methyl-4-(6-methyl-2-pyridinyl)-5-(4-methylsulfonylphenyl)furan-3-one |
|---|---|
| PubChem CID | 18385609 |
| Molecular Formula | C20H21NO4S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 2-ethyl-2-methyl-4-(6-methyl-2-pyridinyl)-5-(4-methylsulfonylphenyl)furan-3-one |
| SMILES | CCC1(C)OC(c2ccc(S(C)(=O)=O)cc2)=C(c2cccc(C)n2)C1=O |
| InChI | InChI=1S/C20H21NO4S/c1-5-20(3)19(22)17(16-8-6-7-13(2)21-16)18(25-20)14-9-11-15(12-10-14)26(4,23)24/h6-12H,5H2,1-4H3 |
| InChIKey | MTEATSCGGIWRIS-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |