C21H18ClF3O4S — CID 18385743
4-[4-chloro-3-(trifluoromethyl)phenyl]-2-ethyl-2-methyl-5-(4-methylsulfonylphenyl)furan-3-one (PubChem CID 18385743) has the molecular formula C21H18ClF3O4S and a molecular weight of 458.89 g/mol. Its IUPAC name is 4-[4-chloro-3-(trifluoromethyl)phenyl]-2-ethyl-2-methyl-5-(4-methylsulfonylphenyl)furan-3-one.
| Compound Name | 4-[4-chloro-3-(trifluoromethyl)phenyl]-2-ethyl-2-methyl-5-(4-methylsulfonylphenyl)furan-3-one |
|---|---|
| PubChem CID | 18385743 |
| Molecular Formula | C21H18ClF3O4S |
| Molecular Weight | 458.89 g/mol |
| Exact Mass | 458.06 |
| IUPAC Name | 4-[4-chloro-3-(trifluoromethyl)phenyl]-2-ethyl-2-methyl-5-(4-methylsulfonylphenyl)furan-3-one |
| SMILES | CCC1(C)OC(c2ccc(S(C)(=O)=O)cc2)=C(c2ccc(Cl)c(C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C21H18ClF3O4S/c1-4-20(2)19(26)17(13-7-10-16(22)15(11-13)21(23,24)25)18(29-20)12-5-8-14(9-6-12)30(3,27)28/h5-11H,4H2,1-3H3 |
| InChIKey | ZEOBMQDTXWEIMZ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.89 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|