C21H22O6S2 — CID 18385593
4-(4-ethylsulfonylphenyl)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-one (PubChem CID 18385593) has the molecular formula C21H22O6S2 and a molecular weight of 434.54 g/mol. Its IUPAC name is 4-(4-ethylsulfonylphenyl)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-one.
| Compound Name | 4-(4-ethylsulfonylphenyl)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-one |
|---|---|
| PubChem CID | 18385593 |
| Molecular Formula | C21H22O6S2 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | 4-(4-ethylsulfonylphenyl)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-one |
| SMILES | CCS(=O)(=O)c1ccc(C2=C(c3ccc(S(C)(=O)=O)cc3)OC(C)(C)C2=O)cc1 |
| InChI | InChI=1S/C21H22O6S2/c1-5-29(25,26)17-12-6-14(7-13-17)18-19(27-21(2,3)20(18)22)15-8-10-16(11-9-15)28(4,23)24/h6-13H,5H2,1-4H3 |
| InChIKey | DMPLRIDJHAOHSE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|